C21H30ClN5O2S — CID 4676175
2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropylcarbamoyl)acetamide (PubChem CID 4676175) has the molecular formula C21H30ClN5O2S and a molecular weight of 452.02 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropylcarbamoyl)acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 4676175 |
| Molecular Formula | C21H30ClN5O2S |
| Molecular Weight | 452.02 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylpropylcarbamoyl)acetamide |
| SMILES | CCCCCCn1c(SCC(=O)NC(=O)NCC(C)C)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H30ClN5O2S/c1-4-5-6-7-12-27-19(16-8-10-17(22)11-9-16)25-26-21(27)30-14-18(28)24-20(29)23-13-15(2)3/h8-11,15H,4-7,12-14H2,1-3H3,(H2,23,24,28,29) |
| InChIKey | DHXQSCDTBUWEAD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.02 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|