C20H23ClN4OS — CID 3959206
2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1H-pyrrol-2-yl)ethanone (PubChem CID 3959206) has the molecular formula C20H23ClN4OS and a molecular weight of 402.95 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1H-pyrrol-2-yl)ethanone.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1H-pyrrol-2-yl)ethanone |
|---|---|
| PubChem CID | 3959206 |
| Molecular Formula | C20H23ClN4OS |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-1-(1H-pyrrol-2-yl)ethanone |
| SMILES | CCCCCCn1c(SCC(=O)c2ccc[nH]2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H23ClN4OS/c1-2-3-4-5-13-25-19(15-8-10-16(21)11-9-15)23-24-20(25)27-14-18(26)17-7-6-12-22-17/h6-12,22H,2-5,13-14H2,1H3 |
| InChIKey | DMTKBOITZREYGS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|