C24H33ClN4O3S — CID 55318266
ethyl 1-[2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]piperidine-4-carboxylate (PubChem CID 55318266) has the molecular formula C24H33ClN4O3S and a molecular weight of 493.07 g/mol. Its IUPAC name is ethyl 1-[2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55318266 |
| Molecular Formula | C24H33ClN4O3S |
| Molecular Weight | 493.07 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | ethyl 1-[2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]piperidine-4-carboxylate |
| SMILES | CCCCCCn1c(SCC(=O)N2CCC(C(=O)OCC)CC2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H33ClN4O3S/c1-3-5-6-7-14-29-22(18-8-10-20(25)11-9-18)26-27-24(29)33-17-21(30)28-15-12-19(13-16-28)23(31)32-4-2/h8-11,19H,3-7,12-17H2,1-2H3 |
| InChIKey | MUZSWLSMCFAWPL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.07 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|