C20H28ClN5O2S — CID 24587298
N-carbamoyl-3-[[5-(4-chlorophenyl)-4-octyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 24587298) has the molecular formula C20H28ClN5O2S and a molecular weight of 438.00 g/mol. Its IUPAC name is N-carbamoyl-3-[[5-(4-chlorophenyl)-4-octyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-carbamoyl-3-[[5-(4-chlorophenyl)-4-octyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 24587298 |
| Molecular Formula | C20H28ClN5O2S |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-carbamoyl-3-[[5-(4-chlorophenyl)-4-octyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CCCCCCCCn1c(SCCC(=O)NC(N)=O)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H28ClN5O2S/c1-2-3-4-5-6-7-13-26-18(15-8-10-16(21)11-9-15)24-25-20(26)29-14-12-17(27)23-19(22)28/h8-11H,2-7,12-14H2,1H3,(H3,22,23,27,28) |
| InChIKey | BJRUSVQQLCOBKC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|