C21H28ClN5O2S — CID 35358743
3-[2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 35358743) has the molecular formula C21H28ClN5O2S and a molecular weight of 450.01 g/mol. Its IUPAC name is 3-[2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 35358743 |
| Molecular Formula | C21H28ClN5O2S |
| Molecular Weight | 450.01 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3-[2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCCCCCn1c(SCCN2C(=O)NC(C)(C)C2=O)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H28ClN5O2S/c1-4-5-6-7-12-26-17(15-8-10-16(22)11-9-15)24-25-20(26)30-14-13-27-18(28)21(2,3)23-19(27)29/h8-11H,4-7,12-14H2,1-3H3,(H,23,29) |
| InChIKey | NHZDDODQICQOQH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.01 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|