C13H16ClN3O2S — CID 79527723
3-[2-(2-amino-5-chlorophenyl)sulfanylethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 79527723) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is 3-[2-(2-amino-5-chlorophenyl)sulfanylethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(2-amino-5-chlorophenyl)sulfanylethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 79527723 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-[2-(2-amino-5-chlorophenyl)sulfanylethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCSc2cc(Cl)ccc2N)C1=O |
| InChI | InChI=1S/C13H16ClN3O2S/c1-13(2)11(18)17(12(19)16-13)5-6-20-10-7-8(14)3-4-9(10)15/h3-4,7H,5-6,15H2,1-2H3,(H,16,19) |
| InChIKey | JDKOGAXZOVBPHK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|