C18H15Cl2FN2O2S — CID 7181192
(5R)-5-(2,4-dichlorophenyl)-3-[2-(2-fluorophenyl)sulfanylethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 7181192) has the molecular formula C18H15Cl2FN2O2S and a molecular weight of 413.30 g/mol. Its IUPAC name is (5R)-5-(2,4-dichlorophenyl)-3-[2-(2-fluorophenyl)sulfanylethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2,4-dichlorophenyl)-3-[2-(2-fluorophenyl)sulfanylethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7181192 |
| Molecular Formula | C18H15Cl2FN2O2S |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | (5R)-5-(2,4-dichlorophenyl)-3-[2-(2-fluorophenyl)sulfanylethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccc(Cl)cc2Cl)NC(=O)N(CCSc2ccccc2F)C1=O |
| InChI | InChI=1S/C18H15Cl2FN2O2S/c1-18(12-7-6-11(19)10-13(12)20)16(24)23(17(25)22-18)8-9-26-15-5-3-2-4-14(15)21/h2-7,10H,8-9H2,1H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | DPNCAQXEKKMZRC-GOSISDBHSA-N |
| XLogP | 4.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|