C9H13N5O2S2 — CID 35358040
3-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 35358040) has the molecular formula C9H13N5O2S2 and a molecular weight of 287.37 g/mol. Its IUPAC name is 3-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 35358040 |
| Molecular Formula | C9H13N5O2S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCSc2nnc(N)s2)C1=O |
| InChI | InChI=1S/C9H13N5O2S2/c1-9(2)5(15)14(7(16)11-9)3-4-17-8-13-12-6(10)18-8/h3-4H2,1-2H3,(H2,10,12)(H,11,16) |
| InChIKey | SMKMROWBILPDRT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|