C10H17N3O4S — CID 107773127
(2S)-2-amino-3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]propanoic acid (PubChem CID 107773127) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 107773127 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | (2S)-2-amino-3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]propanoic acid |
| SMILES | CC1(C)NC(=O)N(CCSC[C@@H](N)C(=O)O)C1=O |
| InChI | InChI=1S/C10H17N3O4S/c1-10(2)8(16)13(9(17)12-10)3-4-18-5-6(11)7(14)15/h6H,3-5,11H2,1-2H3,(H,12,17)(H,14,15)/t6-/m1/s1 |
| InChIKey | DGZVTAQUQFIRGD-ZCFIWIBFSA-N |
| XLogP | -0.54 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|