C11H18N2O2S — CID 75407166
3-[2-[(E)-but-2-enyl]sulfanylethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 75407166) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 3-[2-[(E)-but-2-enyl]sulfanylethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[(E)-but-2-enyl]sulfanylethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75407166 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-[2-[(E)-but-2-enyl]sulfanylethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | C/C=C/CSCCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C11H18N2O2S/c1-4-5-7-16-8-6-13-9(14)11(2,3)12-10(13)15/h4-5H,6-8H2,1-3H3,(H,12,15)/b5-4+ |
| InChIKey | KIPMQULQJMFLOD-SNAWJCMRSA-N |
| XLogP | 1.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|