C10H21N3O2S — CID 82891712
(2R)-2-amino-3-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]propanoic acid (PubChem CID 82891712) has the molecular formula C10H21N3O2S and a molecular weight of 247.36 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 82891712 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (2R)-2-amino-3-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]propanoic acid |
| SMILES | CN1CCN(CCSC[C@H](N)C(=O)O)CC1 |
| InChI | InChI=1S/C10H21N3O2S/c1-12-2-4-13(5-3-12)6-7-16-8-9(11)10(14)15/h9H,2-8,11H2,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | QDRICKYTLNLZOC-VIFPVBQESA-N |
| XLogP | -0.62 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|