C9H19NO2S — CID 61147258
(2R)-2-amino-3-(3,3-dimethylbutylsulfanyl)propanoic acid (PubChem CID 61147258) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is (2R)-2-amino-3-(3,3-dimethylbutylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(3,3-dimethylbutylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 61147258 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (2R)-2-amino-3-(3,3-dimethylbutylsulfanyl)propanoic acid |
| SMILES | CC(C)(C)CCSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H19NO2S/c1-9(2,3)4-5-13-6-7(10)8(11)12/h7H,4-6,10H2,1-3H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | UBURYKKBFNHPMY-ZETCQYMHSA-N |
| XLogP | 1.57 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|