C6H12N2O3S — CID 107772991
(2S)-2-amino-3-(3-amino-3-oxopropyl)sulfanylpropanoic acid (PubChem CID 107772991) has the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-amino-3-oxopropyl)sulfanylpropanoic acid.
| Compound Name | (2S)-2-amino-3-(3-amino-3-oxopropyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 107772991 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (2S)-2-amino-3-(3-amino-3-oxopropyl)sulfanylpropanoic acid |
| SMILES | NC(=O)CCSC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H12N2O3S/c7-4(6(10)11)3-12-2-1-5(8)9/h4H,1-3,7H2,(H2,8,9)(H,10,11)/t4-/m1/s1 |
| InChIKey | UKMONNARIQAYBE-SCSAIBSYSA-N |
| XLogP | -0.99 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|