C10H22N4O — CID 67307542
2-amino-5-(4-methylpiperazin-1-yl)pentanamide (PubChem CID 67307542) has the molecular formula C10H22N4O and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-amino-5-(4-methylpiperazin-1-yl)pentanamide.
| Compound Name | 2-amino-5-(4-methylpiperazin-1-yl)pentanamide |
|---|---|
| PubChem CID | 67307542 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2-amino-5-(4-methylpiperazin-1-yl)pentanamide |
| SMILES | CN1CCN(CCCC(N)C(N)=O)CC1 |
| InChI | InChI=1S/C10H22N4O/c1-13-5-7-14(8-6-13)4-2-3-9(11)10(12)15/h9H,2-8,11H2,1H3,(H2,12,15) |
| InChIKey | LZYMYWNOODJDHZ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |