C12H27N5O — CID 63055069
2-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]butanamide (PubChem CID 63055069) has the molecular formula C12H27N5O and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]butanamide.
| Compound Name | 2-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]butanamide |
|---|---|
| PubChem CID | 63055069 |
| Molecular Formula | C12H27N5O |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.22 |
| IUPAC Name | 2-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]butanamide |
| SMILES | CN(C)CCN1CCN(CCC(N)C(N)=O)CC1 |
| InChI | InChI=1S/C12H27N5O/c1-15(2)5-6-17-9-7-16(8-10-17)4-3-11(13)12(14)18/h11H,3-10,13H2,1-2H3,(H2,14,18) |
| InChIKey | PTTAGLBHOYOYCT-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |