C17H20Cl2N2O2S — CID 7703177
(5R,6S)-3-[2-(2,5-dichlorophenyl)sulfanylethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 7703177) has the molecular formula C17H20Cl2N2O2S and a molecular weight of 387.33 g/mol. Its IUPAC name is (5R,6S)-3-[2-(2,5-dichlorophenyl)sulfanylethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6S)-3-[2-(2,5-dichlorophenyl)sulfanylethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 7703177 |
| Molecular Formula | C17H20Cl2N2O2S |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (5R,6S)-3-[2-(2,5-dichlorophenyl)sulfanylethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@H]1CCCC[C@@]12NC(=O)N(CCSc1cc(Cl)ccc1Cl)C2=O |
| InChI | InChI=1S/C17H20Cl2N2O2S/c1-11-4-2-3-7-17(11)15(22)21(16(23)20-17)8-9-24-14-10-12(18)5-6-13(14)19/h5-6,10-11H,2-4,7-9H2,1H3,(H,20,23)/t11-,17+/m0/s1 |
| InChIKey | IWIHIKGJJJLJMU-APPDUMDISA-N |
| XLogP | 4.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|