C19H23Cl2N3O3 — CID 6591160
N-[2-(2,4-dichlorophenyl)ethyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 6591160) has the molecular formula C19H23Cl2N3O3 and a molecular weight of 412.32 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 6591160 |
| Molecular Formula | C19H23Cl2N3O3 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | C[C@H]1CCCC[C@]12NC(=O)N(CC(=O)NCCc1ccc(Cl)cc1Cl)C2=O |
| InChI | InChI=1S/C19H23Cl2N3O3/c1-12-4-2-3-8-19(12)17(26)24(18(27)23-19)11-16(25)22-9-7-13-5-6-14(20)10-15(13)21/h5-6,10,12H,2-4,7-9,11H2,1H3,(H,22,25)(H,23,27)/t12-,19-/m0/s1 |
| InChIKey | OYPWSPAFWOVWQP-BUXKBTBVSA-N |
| XLogP | 3.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|