C23H34ClN5OS — CID 17481924
2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-ethylpiperidin-4-yl)acetamide (PubChem CID 17481924) has the molecular formula C23H34ClN5OS and a molecular weight of 464.08 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-ethylpiperidin-4-yl)acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-ethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 17481924 |
| Molecular Formula | C23H34ClN5OS |
| Molecular Weight | 464.08 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-ethylpiperidin-4-yl)acetamide |
| SMILES | CCCCCCn1c(SCC(=O)NC2CCN(CC)CC2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H34ClN5OS/c1-3-5-6-7-14-29-22(18-8-10-19(24)11-9-18)26-27-23(29)31-17-21(30)25-20-12-15-28(4-2)16-13-20/h8-11,20H,3-7,12-17H2,1-2H3,(H,25,30) |
| InChIKey | JPGPVSAIWRYWGB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.08 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|