C17H18Cl3N3O3S — CID 2415637
3,4-dimethyl-N-[3-oxo-3-[2-(2,4,6-trichlorophenyl)hydrazinyl]propyl]benzenesulfonamide (PubChem CID 2415637) has the molecular formula C17H18Cl3N3O3S and a molecular weight of 450.78 g/mol. Its IUPAC name is 3,4-dimethyl-N-[3-oxo-3-[2-(2,4,6-trichlorophenyl)hydrazinyl]propyl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[3-oxo-3-[2-(2,4,6-trichlorophenyl)hydrazinyl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2415637 |
| Molecular Formula | C17H18Cl3N3O3S |
| Molecular Weight | 450.78 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | 3,4-dimethyl-N-[3-oxo-3-[2-(2,4,6-trichlorophenyl)hydrazinyl]propyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)NNc2c(Cl)cc(Cl)cc2Cl)cc1C |
| InChI | InChI=1S/C17H18Cl3N3O3S/c1-10-3-4-13(7-11(10)2)27(25,26)21-6-5-16(24)22-23-17-14(19)8-12(18)9-15(17)20/h3-4,7-9,21,23H,5-6H2,1-2H3,(H,22,24) |
| InChIKey | ICYSNYKXGVKSNJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.78 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|