C19H24ClN3O3S — CID 55822561
N-[3-chloro-4-(dimethylamino)phenyl]-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide (PubChem CID 55822561) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is N-[3-chloro-4-(dimethylamino)phenyl]-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide.
| Compound Name | N-[3-chloro-4-(dimethylamino)phenyl]-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 55822561 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[3-chloro-4-(dimethylamino)phenyl]-3-[(3,4-dimethylphenyl)sulfonylamino]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)Nc2ccc(N(C)C)c(Cl)c2)cc1C |
| InChI | InChI=1S/C19H24ClN3O3S/c1-13-5-7-16(11-14(13)2)27(25,26)21-10-9-19(24)22-15-6-8-18(23(3)4)17(20)12-15/h5-8,11-12,21H,9-10H2,1-4H3,(H,22,24) |
| InChIKey | BKZPGYSTOGMNRB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|