C16H21N5O4S — CID 55619889
N-[3-[2-(4-methoxypyrimidin-2-yl)hydrazinyl]-3-oxopropyl]-3,4-dimethylbenzenesulfonamide (PubChem CID 55619889) has the molecular formula C16H21N5O4S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[3-[2-(4-methoxypyrimidin-2-yl)hydrazinyl]-3-oxopropyl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[3-[2-(4-methoxypyrimidin-2-yl)hydrazinyl]-3-oxopropyl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55619889 |
| Molecular Formula | C16H21N5O4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[3-[2-(4-methoxypyrimidin-2-yl)hydrazinyl]-3-oxopropyl]-3,4-dimethylbenzenesulfonamide |
| SMILES | COc1ccnc(NNC(=O)CCNS(=O)(=O)c2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C16H21N5O4S/c1-11-4-5-13(10-12(11)2)26(23,24)18-9-6-14(22)20-21-16-17-8-7-15(19-16)25-3/h4-5,7-8,10,18H,6,9H2,1-3H3,(H,20,22)(H,17,19,21) |
| InChIKey | BSTCOEPWHYIAHE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|