C20H22N4O5S — CID 24635797
N-[3-[2-[2-(4-cyanophenoxy)acetyl]hydrazinyl]-3-oxopropyl]-3,4-dimethylbenzenesulfonamide (PubChem CID 24635797) has the molecular formula C20H22N4O5S and a molecular weight of 430.49 g/mol. Its IUPAC name is N-[3-[2-[2-(4-cyanophenoxy)acetyl]hydrazinyl]-3-oxopropyl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[3-[2-[2-(4-cyanophenoxy)acetyl]hydrazinyl]-3-oxopropyl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 24635797 |
| Molecular Formula | C20H22N4O5S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-[3-[2-[2-(4-cyanophenoxy)acetyl]hydrazinyl]-3-oxopropyl]-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(=O)NNC(=O)COc2ccc(C#N)cc2)cc1C |
| InChI | InChI=1S/C20H22N4O5S/c1-14-3-8-18(11-15(14)2)30(27,28)22-10-9-19(25)23-24-20(26)13-29-17-6-4-16(12-21)5-7-17/h3-8,11,22H,9-10,13H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | AXXHEOMYMQUVOH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 137.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|