C20H20N4O4 — CID 18229898
N-[2-[2-[2-(4-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-3,4-dimethylbenzamide (PubChem CID 18229898) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[2-[2-[2-(4-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-[2-[2-(4-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 18229898 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[2-[2-[2-(4-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)NNC(=O)COc2ccc(C#N)cc2)cc1C |
| InChI | InChI=1S/C20H20N4O4/c1-13-3-6-16(9-14(13)2)20(27)22-11-18(25)23-24-19(26)12-28-17-7-4-15(10-21)5-8-17/h3-9H,11-12H2,1-2H3,(H,22,27)(H,23,25)(H,24,26) |
| InChIKey | FSRXKTKDHRZFIY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|