C23H26N4O4 — CID 41273245
4-tert-butyl-N-[2-[2-[(2S)-2-(4-cyanophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 41273245) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[2-[(2S)-2-(4-cyanophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[2-[(2S)-2-(4-cyanophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 41273245 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 4-tert-butyl-N-[2-[2-[(2S)-2-(4-cyanophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | C[C@H](Oc1ccc(C#N)cc1)C(=O)NNC(=O)CNC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-15(31-19-11-5-16(13-24)6-12-19)21(29)27-26-20(28)14-25-22(30)17-7-9-18(10-8-17)23(2,3)4/h5-12,15H,14H2,1-4H3,(H,25,30)(H,26,28)(H,27,29)/t15-/m0/s1 |
| InChIKey | KYEUIXKPLPBSNU-HNNXBMFYSA-N |
| XLogP | 2.20 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|