C22H24N4O4 — CID 4850375
4-tert-butyl-N-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 4850375) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 4850375 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 4-tert-butyl-N-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(=O)NNC(=O)COc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C22H24N4O4/c1-22(2,3)17-10-8-15(9-11-17)21(29)24-13-19(27)25-26-20(28)14-30-18-7-5-4-6-16(18)12-23/h4-11H,13-14H2,1-3H3,(H,24,29)(H,25,27)(H,26,28) |
| InChIKey | ZKSANDQDRCTZBW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|