C18H15IN4O4 — CID 35946068
N-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-2-iodobenzamide (PubChem CID 35946068) has the molecular formula C18H15IN4O4 and a molecular weight of 478.25 g/mol. Its IUPAC name is N-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-2-iodobenzamide.
| Compound Name | N-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 35946068 |
| Molecular Formula | C18H15IN4O4 |
| Molecular Weight | 478.25 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | N-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-2-iodobenzamide |
| SMILES | N#Cc1ccccc1OCC(=O)NNC(=O)CNC(=O)c1ccccc1I |
| InChI | InChI=1S/C18H15IN4O4/c19-14-7-3-2-6-13(14)18(26)21-10-16(24)22-23-17(25)11-27-15-8-4-1-5-12(15)9-20/h1-8H,10-11H2,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | RACHOITVWHJACP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|