C18H17N5O4 — CID 18292956
1-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-3-phenylurea (PubChem CID 18292956) has the molecular formula C18H17N5O4 and a molecular weight of 367.37 g/mol. Its IUPAC name is 1-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-3-phenylurea.
| Compound Name | 1-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-3-phenylurea |
|---|---|
| PubChem CID | 18292956 |
| Molecular Formula | C18H17N5O4 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-[2-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-2-oxoethyl]-3-phenylurea |
| SMILES | N#Cc1ccccc1OCC(=O)NNC(=O)CNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H17N5O4/c19-10-13-6-4-5-9-15(13)27-12-17(25)23-22-16(24)11-20-18(26)21-14-7-2-1-3-8-14/h1-9H,11-12H2,(H,22,24)(H,23,25)(H2,20,21,26) |
| InChIKey | FMTQXGJADVDLLH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|