C14H10Cl3N3O2 — CID 30859138
4-[(2,4,6-trichloroanilino)carbamoyl]benzamide (PubChem CID 30859138) has the molecular formula C14H10Cl3N3O2 and a molecular weight of 358.61 g/mol. Its IUPAC name is 4-[(2,4,6-trichloroanilino)carbamoyl]benzamide.
| Compound Name | 4-[(2,4,6-trichloroanilino)carbamoyl]benzamide |
|---|---|
| PubChem CID | 30859138 |
| Molecular Formula | C14H10Cl3N3O2 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 4-[(2,4,6-trichloroanilino)carbamoyl]benzamide |
| SMILES | NC(=O)c1ccc(C(=O)NNc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H10Cl3N3O2/c15-9-5-10(16)12(11(17)6-9)19-20-14(22)8-3-1-7(2-4-8)13(18)21/h1-6,19H,(H2,18,21)(H,20,22) |
| InChIKey | LFLRMIVGLLCXTJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|