C13H10Cl3N3O2 — CID 35556076
1-methyl-2-oxo-N'-(2,4,6-trichlorophenyl)pyridine-4-carbohydrazide (PubChem CID 35556076) has the molecular formula C13H10Cl3N3O2 and a molecular weight of 346.60 g/mol. Its IUPAC name is 1-methyl-2-oxo-N'-(2,4,6-trichlorophenyl)pyridine-4-carbohydrazide.
| Compound Name | 1-methyl-2-oxo-N'-(2,4,6-trichlorophenyl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 35556076 |
| Molecular Formula | C13H10Cl3N3O2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 1-methyl-2-oxo-N'-(2,4,6-trichlorophenyl)pyridine-4-carbohydrazide |
| SMILES | Cn1ccc(C(=O)NNc2c(Cl)cc(Cl)cc2Cl)cc1=O |
| InChI | InChI=1S/C13H10Cl3N3O2/c1-19-3-2-7(4-11(19)20)13(21)18-17-12-9(15)5-8(14)6-10(12)16/h2-6,17H,1H3,(H,18,21) |
| InChIKey | WXNLKTSGVAMFOB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|