C14H13Cl3N4O2 — CID 34933662
6-oxo-1-propyl-N'-(2,4,6-trichlorophenyl)pyridazine-3-carbohydrazide (PubChem CID 34933662) has the molecular formula C14H13Cl3N4O2 and a molecular weight of 375.64 g/mol. Its IUPAC name is 6-oxo-1-propyl-N'-(2,4,6-trichlorophenyl)pyridazine-3-carbohydrazide.
| Compound Name | 6-oxo-1-propyl-N'-(2,4,6-trichlorophenyl)pyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 34933662 |
| Molecular Formula | C14H13Cl3N4O2 |
| Molecular Weight | 375.64 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 6-oxo-1-propyl-N'-(2,4,6-trichlorophenyl)pyridazine-3-carbohydrazide |
| SMILES | CCCn1nc(C(=O)NNc2c(Cl)cc(Cl)cc2Cl)ccc1=O |
| InChI | InChI=1S/C14H13Cl3N4O2/c1-2-5-21-12(22)4-3-11(20-21)14(23)19-18-13-9(16)6-8(15)7-10(13)17/h3-4,6-7,18H,2,5H2,1H3,(H,19,23) |
| InChIKey | JODOSKJLRUZVMR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.64 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|