C13H11Cl3N2OS — CID 30859132
3-thiophen-2-yl-N'-(2,4,6-trichlorophenyl)propanehydrazide (PubChem CID 30859132) has the molecular formula C13H11Cl3N2OS and a molecular weight of 349.67 g/mol. Its IUPAC name is 3-thiophen-2-yl-N'-(2,4,6-trichlorophenyl)propanehydrazide.
| Compound Name | 3-thiophen-2-yl-N'-(2,4,6-trichlorophenyl)propanehydrazide |
|---|---|
| PubChem CID | 30859132 |
| Molecular Formula | C13H11Cl3N2OS |
| Molecular Weight | 349.67 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 3-thiophen-2-yl-N'-(2,4,6-trichlorophenyl)propanehydrazide |
| SMILES | O=C(CCc1cccs1)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl3N2OS/c14-8-6-10(15)13(11(16)7-8)18-17-12(19)4-3-9-2-1-5-20-9/h1-2,5-7,18H,3-4H2,(H,17,19) |
| InChIKey | SMOFIJOBUAYPDT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|