C20H18ClN3O4S2 — CID 24540531
N-(4-chlorophenyl)-3-[(3-thiophen-2-ylpropanoylamino)carbamoyl]benzenesulfonamide (PubChem CID 24540531) has the molecular formula C20H18ClN3O4S2 and a molecular weight of 463.97 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[(3-thiophen-2-ylpropanoylamino)carbamoyl]benzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-3-[(3-thiophen-2-ylpropanoylamino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24540531 |
| Molecular Formula | C20H18ClN3O4S2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | N-(4-chlorophenyl)-3-[(3-thiophen-2-ylpropanoylamino)carbamoyl]benzenesulfonamide |
| SMILES | O=C(CCc1cccs1)NNC(=O)c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H18ClN3O4S2/c21-15-6-8-16(9-7-15)24-30(27,28)18-5-1-3-14(13-18)20(26)23-22-19(25)11-10-17-4-2-12-29-17/h1-9,12-13,24H,10-11H2,(H,22,25)(H,23,26) |
| InChIKey | SROUOWCYANVSAJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|