C18H18ClN3O4S — CID 25488156
N-(4-chlorophenyl)-3-[[[(1R,2S)-2-methylcyclopropanecarbonyl]amino]carbamoyl]benzenesulfonamide (PubChem CID 25488156) has the molecular formula C18H18ClN3O4S and a molecular weight of 407.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[[[(1R,2S)-2-methylcyclopropanecarbonyl]amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-3-[[[(1R,2S)-2-methylcyclopropanecarbonyl]amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25488156 |
| Molecular Formula | C18H18ClN3O4S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-(4-chlorophenyl)-3-[[[(1R,2S)-2-methylcyclopropanecarbonyl]amino]carbamoyl]benzenesulfonamide |
| SMILES | C[C@H]1C[C@H]1C(=O)NNC(=O)c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H18ClN3O4S/c1-11-9-16(11)18(24)21-20-17(23)12-3-2-4-15(10-12)27(25,26)22-14-7-5-13(19)6-8-14/h2-8,10-11,16,22H,9H2,1H3,(H,20,23)(H,21,24)/t11-,16+/m0/s1 |
| InChIKey | GXTJBGPHRLAAOP-MEDUHNTESA-N |
| XLogP | 2.56 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|