C21H17BrClN3O3S — CID 2332257
3-[[1-(2-bromophenyl)ethenylamino]carbamoyl]-N-(4-chlorophenyl)benzenesulfonamide (PubChem CID 2332257) has the molecular formula C21H17BrClN3O3S and a molecular weight of 506.81 g/mol. Its IUPAC name is 3-[[1-(2-bromophenyl)ethenylamino]carbamoyl]-N-(4-chlorophenyl)benzenesulfonamide.
| Compound Name | 3-[[1-(2-bromophenyl)ethenylamino]carbamoyl]-N-(4-chlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2332257 |
| Molecular Formula | C21H17BrClN3O3S |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 504.99 |
| IUPAC Name | 3-[[1-(2-bromophenyl)ethenylamino]carbamoyl]-N-(4-chlorophenyl)benzenesulfonamide |
| SMILES | C=C(NNC(=O)c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1)c1ccccc1Br |
| InChI | InChI=1S/C21H17BrClN3O3S/c1-14(19-7-2-3-8-20(19)22)24-25-21(27)15-5-4-6-18(13-15)30(28,29)26-17-11-9-16(23)10-12-17/h2-13,24,26H,1H2,(H,25,27) |
| InChIKey | ZYRVZUBUINLJGY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|