C20H16BrN3O4S — CID 27555836
3-(benzamidocarbamoyl)-N-(4-bromophenyl)benzenesulfonamide (PubChem CID 27555836) has the molecular formula C20H16BrN3O4S and a molecular weight of 474.34 g/mol. Its IUPAC name is 3-(benzamidocarbamoyl)-N-(4-bromophenyl)benzenesulfonamide.
| Compound Name | 3-(benzamidocarbamoyl)-N-(4-bromophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 27555836 |
| Molecular Formula | C20H16BrN3O4S |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | 3-(benzamidocarbamoyl)-N-(4-bromophenyl)benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1cccc(S(=O)(=O)Nc2ccc(Br)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C20H16BrN3O4S/c21-16-9-11-17(12-10-16)24-29(27,28)18-8-4-7-15(13-18)20(26)23-22-19(25)14-5-2-1-3-6-14/h1-13,24H,(H,22,25)(H,23,26) |
| InChIKey | ZRALQFBSASLXIS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|