C21H17BrN2O5S — CID 26583412
methyl 4-[[3-[(4-bromophenyl)sulfamoyl]benzoyl]amino]benzoate (PubChem CID 26583412) has the molecular formula C21H17BrN2O5S and a molecular weight of 489.35 g/mol. Its IUPAC name is methyl 4-[[3-[(4-bromophenyl)sulfamoyl]benzoyl]amino]benzoate.
| Compound Name | methyl 4-[[3-[(4-bromophenyl)sulfamoyl]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 26583412 |
| Molecular Formula | C21H17BrN2O5S |
| Molecular Weight | 489.35 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | methyl 4-[[3-[(4-bromophenyl)sulfamoyl]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cccc(S(=O)(=O)Nc3ccc(Br)cc3)c2)cc1 |
| InChI | InChI=1S/C21H17BrN2O5S/c1-29-21(26)14-5-9-17(10-6-14)23-20(25)15-3-2-4-19(13-15)30(27,28)24-18-11-7-16(22)8-12-18/h2-13,24H,1H3,(H,23,25) |
| InChIKey | PEXRHVFLBDFCIS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |