C21H17F2N3O4S2 — CID 46651951
3-(benzamidocarbamoyl)-N-[4-(difluoromethylsulfanyl)phenyl]benzenesulfonamide (PubChem CID 46651951) has the molecular formula C21H17F2N3O4S2 and a molecular weight of 477.51 g/mol. Its IUPAC name is 3-(benzamidocarbamoyl)-N-[4-(difluoromethylsulfanyl)phenyl]benzenesulfonamide.
| Compound Name | 3-(benzamidocarbamoyl)-N-[4-(difluoromethylsulfanyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46651951 |
| Molecular Formula | C21H17F2N3O4S2 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 3-(benzamidocarbamoyl)-N-[4-(difluoromethylsulfanyl)phenyl]benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1cccc(S(=O)(=O)Nc2ccc(SC(F)F)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H17F2N3O4S2/c22-21(23)31-17-11-9-16(10-12-17)26-32(29,30)18-8-4-7-15(13-18)20(28)25-24-19(27)14-5-2-1-3-6-14/h1-13,21,26H,(H,24,27)(H,25,28) |
| InChIKey | GGJRNYBTPQTNJG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|