C19H16F2N2O3S3 — CID 4836423
N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]-2-thiophen-2-ylacetamide (PubChem CID 4836423) has the molecular formula C19H16F2N2O3S3 and a molecular weight of 454.55 g/mol. Its IUPAC name is N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 4836423 |
| Molecular Formula | C19H16F2N2O3S3 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | N-[3-[[4-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1cccc(S(=O)(=O)Nc2ccc(SC(F)F)cc2)c1 |
| InChI | InChI=1S/C19H16F2N2O3S3/c20-19(21)28-15-8-6-13(7-9-15)23-29(25,26)17-5-1-3-14(11-17)22-18(24)12-16-4-2-10-27-16/h1-11,19,23H,12H2,(H,22,24) |
| InChIKey | PWJRDXIISLYBDG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |