C20H20N2O3S3 — CID 22779737
N-(3-methylphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpropanamide (PubChem CID 22779737) has the molecular formula C20H20N2O3S3 and a molecular weight of 432.59 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpropanamide.
| Compound Name | N-(3-methylphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 22779737 |
| Molecular Formula | C20H20N2O3S3 |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | N-(3-methylphenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpropanamide |
| SMILES | Cc1cccc(NC(=O)C(C)Sc2ccc(NS(=O)(=O)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C20H20N2O3S3/c1-14-5-3-6-17(13-14)21-20(23)15(2)27-18-10-8-16(9-11-18)22-28(24,25)19-7-4-12-26-19/h3-13,15,22H,1-2H3,(H,21,23) |
| InChIKey | XLAOPLKYFUDVMG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |