C21H17N3O5S2 — CID 3891136
[1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 3891136) has the molecular formula C21H17N3O5S2 and a molecular weight of 455.52 g/mol. Its IUPAC name is [1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 3891136 |
| Molecular Formula | C21H17N3O5S2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] 4-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | CC(OC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C21H17N3O5S2/c1-14(20(25)23-18-5-2-4-15(12-18)13-22)29-21(26)16-7-9-17(10-8-16)24-31(27,28)19-6-3-11-30-19/h2-12,14,24H,1H3,(H,23,25) |
| InChIKey | FPRUVRPLPYCXBX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |