C21H19N3O6S2 — CID 24587875
[1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 4-(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 24587875) has the molecular formula C21H19N3O6S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 4-(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 4-(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 24587875 |
| Molecular Formula | C21H19N3O6S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 4-(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | CC(OC(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1)C(=O)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H19N3O6S2/c1-14(19(25)23-21(27)22-16-6-3-2-4-7-16)30-20(26)15-9-11-17(12-10-15)24-32(28,29)18-8-5-13-31-18/h2-14,24H,1H3,(H2,22,23,25,27) |
| InChIKey | XYQPRPGUKJTQKM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |