C19H17ClN2O3S3 — CID 22782899
N-(2-chlorophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpropanamide (PubChem CID 22782899) has the molecular formula C19H17ClN2O3S3 and a molecular weight of 453.01 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpropanamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 22782899 |
| Molecular Formula | C19H17ClN2O3S3 |
| Molecular Weight | 453.01 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpropanamide |
| SMILES | CC(Sc1ccc(NS(=O)(=O)c2cccs2)cc1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H17ClN2O3S3/c1-13(19(23)21-17-6-3-2-5-16(17)20)27-15-10-8-14(9-11-15)22-28(24,25)18-7-4-12-26-18/h2-13,22H,1H3,(H,21,23) |
| InChIKey | GCNGAISEUOKITN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.01 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |