C19H22Cl2N2O3 — CID 112790688
N-[2-(2,4-dichlorophenyl)ethyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide (PubChem CID 112790688) has the molecular formula C19H22Cl2N2O3 and a molecular weight of 397.30 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 112790688 |
| Molecular Formula | C19H22Cl2N2O3 |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanamide |
| SMILES | CC(C(=O)NCCc1ccc(Cl)cc1Cl)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C19H22Cl2N2O3/c1-11(23-18(25)14-4-2-3-5-15(14)19(23)26)17(24)22-9-8-12-6-7-13(20)10-16(12)21/h6-7,10-11,14-15H,2-5,8-9H2,1H3,(H,22,24) |
| InChIKey | RSPIZMPQGCOAGC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|