C19H23FN2O3 — CID 31737906
(2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(3-fluorophenyl)ethyl]propanamide (PubChem CID 31737906) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(3-fluorophenyl)ethyl]propanamide.
| Compound Name | (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(3-fluorophenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 31737906 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(3-fluorophenyl)ethyl]propanamide |
| SMILES | C[C@@H](C(=O)NCCc1cccc(F)c1)N1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C19H23FN2O3/c1-12(17(23)21-10-9-13-5-4-6-14(20)11-13)22-18(24)15-7-2-3-8-16(15)19(22)25/h4-6,11-12,15-16H,2-3,7-10H2,1H3,(H,21,23)/t12-,15-,16+/m0/s1 |
| InChIKey | NLIVZMSIOYCGNJ-VBNZEHGJSA-N |
| XLogP | 2.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|