C16H11Br2NO3 — CID 17335172
5-bromo-N-[[5-(4-bromophenyl)furan-2-yl]methyl]furan-2-carboxamide (PubChem CID 17335172) has the molecular formula C16H11Br2NO3 and a molecular weight of 425.08 g/mol. Its IUPAC name is 5-bromo-N-[[5-(4-bromophenyl)furan-2-yl]methyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[[5-(4-bromophenyl)furan-2-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17335172 |
| Molecular Formula | C16H11Br2NO3 |
| Molecular Weight | 425.08 g/mol |
| Exact Mass | 422.91 |
| IUPAC Name | 5-bromo-N-[[5-(4-bromophenyl)furan-2-yl]methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccc(-c2ccc(Br)cc2)o1)c1ccc(Br)o1 |
| InChI | InChI=1S/C16H11Br2NO3/c17-11-3-1-10(2-4-11)13-6-5-12(21-13)9-19-16(20)14-7-8-15(18)22-14/h1-8H,9H2,(H,19,20) |
| InChIKey | DTMCNGWSJLSTLZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.08 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |