C17H14BrNO2S — CID 24588409
N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-thiophen-3-ylacetamide (PubChem CID 24588409) has the molecular formula C17H14BrNO2S and a molecular weight of 376.28 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 24588409 |
| Molecular Formula | C17H14BrNO2S |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)NCc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C17H14BrNO2S/c18-14-3-1-13(2-4-14)16-6-5-15(21-16)10-19-17(20)9-12-7-8-22-11-12/h1-8,11H,9-10H2,(H,19,20) |
| InChIKey | IMJIBIBUUNUMEN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |