C20H19BrN2O3S — CID 24588444
N-[4-[[5-(4-bromophenyl)furan-2-yl]methylamino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 24588444) has the molecular formula C20H19BrN2O3S and a molecular weight of 447.35 g/mol. Its IUPAC name is N-[4-[[5-(4-bromophenyl)furan-2-yl]methylamino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[[5-(4-bromophenyl)furan-2-yl]methylamino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 24588444 |
| Molecular Formula | C20H19BrN2O3S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | N-[4-[[5-(4-bromophenyl)furan-2-yl]methylamino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)NCc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C20H19BrN2O3S/c21-16-5-3-14(4-6-16)18-8-7-17(26-18)12-23-19(24)2-1-10-22-20(25)15-9-11-27-13-15/h3-9,11,13H,1-2,10,12H2,(H,22,25)(H,23,24) |
| InChIKey | PCRCOLWJWNKJTJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|