C13H15N3O3S — CID 108894217
1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-(2-methylphenyl)urea (PubChem CID 108894217) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 108894217 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 1-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C13H15N3O3S/c1-9-4-2-3-5-10(9)15-12(18)14-6-7-16-11(17)8-20-13(16)19/h2-5H,6-8H2,1H3,(H2,14,15,18) |
| InChIKey | DDQLBTUPKSZKSL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|