C21H27N3O2S2 — CID 3681251
methyl 4-[butyl(methyl)amino]-3-[(3-methylsulfanylphenyl)carbamothioylamino]benzoate (PubChem CID 3681251) has the molecular formula C21H27N3O2S2 and a molecular weight of 417.60 g/mol. Its IUPAC name is methyl 4-[butyl(methyl)amino]-3-[(3-methylsulfanylphenyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-[butyl(methyl)amino]-3-[(3-methylsulfanylphenyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 3681251 |
| Molecular Formula | C21H27N3O2S2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | methyl 4-[butyl(methyl)amino]-3-[(3-methylsulfanylphenyl)carbamothioylamino]benzoate |
| SMILES | CCCCN(C)c1ccc(C(=O)OC)cc1NC(=S)Nc1cccc(SC)c1 |
| InChI | InChI=1S/C21H27N3O2S2/c1-5-6-12-24(2)19-11-10-15(20(25)26-3)13-18(19)23-21(27)22-16-8-7-9-17(14-16)28-4/h7-11,13-14H,5-6,12H2,1-4H3,(H2,22,23,27) |
| InChIKey | SXTLNOQCWXSZHD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|