C19H18N2O6S — CID 108520101
dimethyl 2-[[2-(3-methylsulfanylanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 108520101) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is dimethyl 2-[[2-(3-methylsulfanylanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(3-methylsulfanylanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108520101 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | dimethyl 2-[[2-(3-methylsulfanylanilino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)C(=O)Nc2cccc(SC)c2)c1 |
| InChI | InChI=1S/C19H18N2O6S/c1-26-18(24)11-7-8-14(19(25)27-2)15(9-11)21-17(23)16(22)20-12-5-4-6-13(10-12)28-3/h4-10H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | GARRTLVMFIYACH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|